AP Statistics Flashcards: Confidence Intervals Difference Of Two Means

Study Confidence Intervals Difference Of Two Means in AP Statistics with focused flashcards that help you recognize the idea, recall the key rule, and apply it in practice-style prompts.

AP Statistics

Confidence Intervals Difference Of Two Means

0 mastered0 still learning

0% Complete

QUESTION
1/ 55

What does independence of samples imply in hypothesis testing?

Tap card or press Space to flip

ANSWER

Samples are drawn separately. No overlap or influence between the two sample groups.

How well did you know it?

Card 1 / 55

What this deck covers

This deck focuses on Confidence Intervals Difference Of Two Means, giving you a quick way to review the definitions, rules, and examples that matter most for AP Statistics.

How to use these flashcards

Work through these flashcards in short sessions. Try to answer each prompt before flipping the card, then revisit any cards you miss until the explanation feels automatic.

All flashcards

Flashcard 1: What does independence of samples imply in hypothesis testing?

Answer: Samples are drawn separately. No overlap or influence between the two sample groups.

Flashcard 2: When is the use of a pooled tt-test appropriate?

Answer: When variances are equal. Equal variance assumption justifies pooling sample variances.

Flashcard 3: Identify the condition of random sampling in hypothesis testing.

Answer: Samples must be randomly selected. Ensures samples represent their respective populations without bias.

Flashcard 4: How do you interpret a 95% confidence interval?

Answer: 95% chance the interval contains the true mean difference. Confidence refers to the method, not any specific interval.

Flashcard 5: What is the formula for SE(xˉ1xˉ2)SE( \bar{x}_1 - \bar{x}_2 ) under unequal variances?

Answer: SE=sqrts12n1+s22n2SE = \text{sqrt}\frac{s_1^2}{n_1} + \frac{s_2^2}{n_2}. Used when population variances are not assumed equal (Welch's method).

Flashcard 6: Identify the condition of random sampling in hypothesis testing.

Answer: Samples must be randomly selected. Ensures samples represent their respective populations without bias.

Flashcard 7: What is the primary purpose of a confidence interval for two means?

Answer: Estimate the difference between population means. Provides range of plausible values for the true difference.

Flashcard 8: What does SE(xˉ1xˉ2)SE( \bar{x}_1 - \bar{x}_2 ) represent in the formula?

Answer: Standard error of the difference of the two means. Measures variability of the difference between sample means.

Flashcard 9: How is the degrees of freedom calculated for two means under unequal variances?

Answer: Use the Welch-Satterthwaite equation. Complex formula accounts for unequal variances and sample sizes.

Flashcard 10: What is the role of the critical value in a confidence interval?

Answer: Defines the interval width based on confidence level. Determines margin of error based on desired confidence level.

Flashcard 11: How does increasing the sample variance affect the confidence interval?

Answer: The interval becomes wider. Greater variability increases uncertainty in the estimate.

Flashcard 12: Which distribution is used when population variances are unknown?

Answer: tt-distribution. Accounts for additional uncertainty when σ\sigma is unknown.

Flashcard 13: Identify the effect of violating the equal variance assumption.

Answer: Leads to incorrect interval estimation. Using pooled method when variances differ gives incorrect results.

Flashcard 14: What does the term 'robust' mean in statistical analysis?

Answer: Insensitive to violations of assumptions. Method performs well even when assumptions are moderately violated.

Flashcard 15: How do you calculate sps_p?

Answer: sp=sqrt(n11)s12+(n21)s22n1+n22s_p = \text{sqrt}\frac{(n_1-1)s_1^2 + (n_2-1)s_2^2}{n_1 + n_2 - 2}. Weighted average of sample variances using degrees of freedom.

Flashcard 16: How does the sample variance affect the standard error?

Answer: Larger variance increases standard error. More variability leads to greater uncertainty in estimates.

Flashcard 17: What is the null hypothesis for testing the difference between two means?

Answer: H0:xˉ1xˉ2=0H_0: \bar{x}_1 - \bar{x}_2 = 0. States no difference between the two population means.

Flashcard 18: What does a two-sample tt-test evaluate?

Answer: Difference between two population means. Compares means from two independent populations or groups.

Flashcard 19: What is the alternative hypothesis for a two-tailed test of means?

Answer: Ha:xˉ1xˉ20H_a: \bar{x}_1 - \bar{x}_2 \neq 0. Tests whether means are significantly different in either direction.

Flashcard 20: What does a two-sample tt-test evaluate?

Answer: Difference between two population means. Compares means from two independent populations or groups.

Flashcard 21: When is the use of a pooled tt-test appropriate?

Answer: When variances are equal. Equal variance assumption justifies pooling sample variances.

Flashcard 22: Find the critical value tt^* for a 95% confidence interval with df=10.

Answer: Use a tt-table or calculator. Critical value approximately 2.228 for 95% confidence with df=10.

Flashcard 23: What is sps_p in the context of two means?

Answer: Pooled standard deviation. Combines both sample standard deviations when variances are equal.

Flashcard 24: Find the critical value tt^* for a 95% confidence interval with df=10.

Answer: Use a tt-table or calculator. Critical value approximately 2.228 for 95% confidence with df=10.

Flashcard 25: What is the formula for the confidence interval for the difference of two means?

Answer: (xˉ1xˉ2)±t×SE(xˉ1xˉ2)( \bar{x}_1 - \bar{x}_2 ) \pm t^* \times SE( \bar{x}_1 - \bar{x}_2 ). Standard formula using sample means, critical value, and standard error.

Flashcard 26: When can the normal approximation be used instead of the tt-distribution?

Answer: Large sample sizes. tt-distribution approaches normal as sample sizes increase (CLT).

Flashcard 27: What assumption about variances is made in a pooled tt-test?

Answer: Equal variances. Allows combining sample variances for more efficient estimation.

Flashcard 28: What is the result if the confidence interval does not include zero?

Answer: Significant difference. Zero is outside the interval, indicating meaningful difference.

Flashcard 29: State the formula for calculating a confidence interval.

Answer: (xˉ1xˉ2)±t×SE(xˉ1xˉ2)( \bar{x}_1 - \bar{x}_2 ) \pm t^* \times SE( \bar{x}_1 - \bar{x}_2 ). General structure: point estimate plus/minus margin of error.

Flashcard 30: What does a confidence interval that includes zero suggest?

Answer: No significant difference. Zero difference falls within plausible range of values.

Flashcard 31: What is the result if the confidence interval does not include zero?

Answer: Significant difference. Zero is outside the interval, indicating meaningful difference.

Flashcard 32: How does the choice of confidence level affect the interval?

Answer: Higher confidence level widens the interval. Trade-off between confidence and precision in estimation.

Flashcard 33: What is the impact of a wider confidence interval on interpretation?

Answer: Less precision in estimating the mean difference. Wide intervals provide less specific information about the difference.

Flashcard 34: What is the effect of increasing sample size on the width of a confidence interval?

Answer: The interval becomes narrower. Larger samples reduce standard error, improving precision.

Flashcard 35: Identify the impact of a larger sample size on the standard error.

Answer: The standard error decreases. Larger samples provide more precise estimates with smaller error.

Flashcard 36: What is the role of sample means in constructing confidence intervals?

Answer: Estimate the population means. Sample means provide point estimates of unknown population parameters.

Flashcard 37: How does increasing the sample variance affect the confidence interval?

Answer: The interval becomes wider. Greater variability increases uncertainty in the estimate.

Flashcard 38: What conditions must be met for using the tt-distribution for two means?

Answer: Normality, independence, and random sampling. Essential assumptions for valid tt-distribution inference.

Flashcard 39: What is the role of sample means in constructing confidence intervals?

Answer: Estimate the population means. Sample means provide point estimates of unknown population parameters.

Flashcard 40: What is the null hypothesis for testing the difference between two means?

Answer: H0:xˉ1xˉ2=0H_0: \bar{x}_1 - \bar{x}_2 = 0. States no difference between the two population means.

Flashcard 41: Identify the term tt^* in the confidence interval formula for two means.

Answer: tt^* is the critical value from the tt-distribution. Found from tt-distribution table based on confidence level and degrees of freedom.

Flashcard 42: What is the primary purpose of a confidence interval for two means?

Answer: Estimate the difference between population means. Provides range of plausible values for the true difference.

Flashcard 43: What is the assumption of normality in confidence intervals?

Answer: Data are approximately normally distributed. Required for valid use of tt-distribution methods.

Flashcard 44: Identify the impact of a larger confidence level on the interval.

Answer: The interval becomes wider. Higher confidence requires wider interval to maintain certainty.

Flashcard 45: Identify the sampling distribution for the difference of sample means.

Answer: tt-distribution. Difference of means follows tt-distribution under standard assumptions.

Flashcard 46: What is the role of the critical value in a confidence interval?

Answer: Defines the interval width based on confidence level. Determines margin of error based on desired confidence level.

Flashcard 47: What does a confidence interval that includes zero suggest?

Answer: No significant difference. Zero difference falls within plausible range of values.

Flashcard 48: What is the formula for the confidence interval for the difference of two means?

Answer: (xˉ1xˉ2)±t×SE(xˉ1xˉ2)( \bar{x}_1 - \bar{x}_2 ) \pm t^* \times SE( \bar{x}_1 - \bar{x}_2 ). Standard formula using sample means, critical value, and standard error.

Flashcard 49: How is the degrees of freedom calculated for two means under equal variances?

Answer: df=n1+n22df = n_1 + n_2 - 2. Total sample size minus 2 when using pooled variance.

Flashcard 50: What is the effect of increasing sample size on the width of a confidence interval?

Answer: The interval becomes narrower. Larger samples reduce standard error, improving precision.

Flashcard 51: What is the impact of a wider confidence interval on interpretation?

Answer: Less precision in estimating the mean difference. Wide intervals provide less specific information about the difference.

Flashcard 52: How do you interpret a 95% confidence interval?

Answer: 95% chance the interval contains the true mean difference. Confidence refers to the method, not any specific interval.

Flashcard 53: What does the term 'robust' mean in statistical analysis?

Answer: Insensitive to violations of assumptions. Method performs well even when assumptions are moderately violated.

Flashcard 54: How does the sample variance affect the standard error?

Answer: Larger variance increases standard error. More variability leads to greater uncertainty in estimates.

Flashcard 55: What is the assumption of normality in confidence intervals?

Answer: Data are approximately normally distributed. Required for valid use of tt-distribution methods.