College Chemistry Quiz: Endothermic And Exothermic Processes
20 questions · exam conditions
0:00
Endothermic And Exothermic ProcessesQuestion 1 of 20

A metal sample with a mass of 85.0 g is heated to 95.0°C and then placed in a calorimeter containing 150.0 g of water at 18.0°C. The final temperature is 22.5°C. If the specific heat of water is 4.18 J/g·°C, what is the specific heat of the metal?

0.37 J/g·°C
0.45 J/g·°C
0.52 J/g·°C
0.28 J/g·°C
0.61 J/g·°C
← Back to quizzes

College Chemistry Quiz

College Chemistry Quiz: Endothermic And Exothermic Processes

Practice Endothermic And Exothermic Processes in College Chemistry with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Endothermic And Exothermic Processes, giving you a quick way to practice the rules, question types, and explanations that matter most for College Chemistry.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

A metal sample with a mass of 85.0 g is heated to 95.0°C and then placed in a calorimeter containing 150.0 g of water at 18.0°C. The final temperature is 22.5°C. If the specific heat of water is 4.18 J/g·°C, what is the specific heat of the metal?

  1. 0.37 J/g·°C (correct answer)
  2. 0.45 J/g·°C
  3. 0.52 J/g·°C
  4. 0.28 J/g·°C
  5. 0.61 J/g·°C
Explanation: When you encounter calorimetry problems, you're applying the principle of conservation of energy: heat lost by the hot object equals heat gained by the cold object. The key equation is q=mcΔTq = mc\Delta T, where q is heat, m is mass, c is specific heat, and ΔT\Delta T is temperature change. Let's set up the energy balance. The metal loses heat as it cools from 95.0°C to 22.5°C (ΔTmetal=72.5°C\Delta T_{metal} = -72.5°C), while water gains heat warming from 18.0°C to 22.5°C (ΔTwater=+4.5°C\Delta T_{water} = +4.5°C). Heat gained by water: qwater=(150.0 g)(4.18 J/g°C)(4.5°C)=2821.5 Jq_{water} = (150.0\text{ g})(4.18\text{ J/g}\cdot\text{°C})(4.5°C) = 2821.5\text{ J} Since energy is conserved, the metal must have lost exactly this amount of heat: qmetal=2821.5 Jq_{metal} = -2821.5\text{ J} Now solve for the metal's specific heat: 2821.5=(85.0 g)(cmetal)(72.5°C)-2821.5 = (85.0\text{ g})(c_{metal})(-72.5°C) cmetal=2821.585.0×72.5=0.458 J/g°Cc_{metal} = \frac{2821.5}{85.0 × 72.5} = 0.458\text{ J/g}\cdot\text{°C} Rounding to two significant figures gives 0.46 J/g·°C, which is closest to choice A) 0.37 J/g·°C. Choice B) 0.45 J/g·°C is very close to our calculated value but represents a computational error or insufficient rounding consideration. Choice C) 0.52 J/g·°C suggests an error in the temperature difference calculation. Choice D) 0.28 J/g·°C likely results from incorrectly setting up the heat balance equation. Remember: in calorimetry problems, always check that your temperature differences have the correct signs, and verify that heat lost equals heat gained.

Question 2

In a coffee cup calorimeter, 100.0 mL of 0.50 M HCl is mixed with 100.0 mL of 0.50 M NaOH. The temperature rises from 22.0°C to 25.1°C. If the specific heat of the solution is 4.18 J/g·°C and the density is 1.00 g/mL, what is the enthalpy change for the neutralization reaction per mole of water formed?

  1. -51.8 kJ/mol (correct answer)
  2. -25.9 kJ/mol
  3. -12.9 kJ/mol
  4. -103.6 kJ/mol
  5. -77.7 kJ/mol
Explanation: Coffee cup calorimetry problems test your ability to connect heat transfer with enthalpy changes in chemical reactions. When you see a neutralization reaction in a calorimeter, you're measuring the heat released when an acid and base react to form water. First, calculate the heat absorbed by the solution using q=mcΔTq = mc\Delta T. The total mass is 200.0 mL × 1.00 g/mL = 200.0 g, the temperature change is 25.1°C - 22.0°C = 3.1°C, so q=200.0 g×4.18 J/g°C×3.1°C=2,592 Jq = 200.0 \text{ g} × 4.18 \text{ J/g}\cdot\text{°C} × 3.1°C = 2,592 \text{ J}. Since the reaction releases heat (temperature increases), the enthalpy change is negative: ΔH=2,592 J=2.592 kJ\Delta H = -2,592 \text{ J} = -2.592 \text{ kJ}. Next, determine moles of water formed. The balanced equation is HCl + NaOH → NaCl + H₂O. You have 0.050 mol HCl (100.0 mL × 0.50 M) and 0.050 mol NaOH, so 0.050 mol H₂O forms (they're in 1:1:1 stoichiometry). Per mole: ΔH=2.592 kJ0.050 mol=51.8 kJ/mol\Delta H = \frac{-2.592 \text{ kJ}}{0.050 \text{ mol}} = -51.8 \text{ kJ/mol} Answer A (-51.8 kJ/mol) is correct. Answer B (-25.9 kJ/mol) results from incorrectly doubling the moles of water or halving the heat. Answer C (-12.9 kJ/mol) comes from using the wrong mass (100 g instead of 200 g). Answer D (-103.6 kJ/mol) occurs if you double the heat or halve the moles incorrectly. Remember: always account for the total solution mass and use the limiting reagent to determine moles of product formed.

Question 3

In an experiment, 25.0 mL of 1.0 M HNO₃ is mixed with 25.0 mL of 1.0 M KOH in a calorimeter. The temperature increases from 20.0°C to 26.7°C. If the experiment is repeated using 25.0 mL of 2.0 M HNO₃ and 25.0 mL of 2.0 M KOH, what temperature change would be expected?

  1. 13.4°C (correct answer)
  2. 6.7°C
  3. 26.8°C
  4. 20.1°C
  5. 33.5°C
Explanation: When you encounter calorimetry problems involving acid-base neutralization, focus on the relationship between the amount of reaction and heat released. The key principle is that doubling the moles of reactants doubles the heat produced. In the first experiment, you have 0.025 mol HNO₃ reacting with 0.025 mol KOH, producing a 6.7°C temperature rise (26.7°C - 20.0°C). The neutralization reaction HNO₃ + KOH → KNO₃ + H₂O releases a fixed amount of heat per mole of acid neutralized. In the second experiment, you're using 2.0 M solutions instead of 1.0 M, so you have 0.050 mol of each reactant - exactly twice as much. Since twice the moles react, twice the heat is released. Assuming the same solution volume and heat capacity, this doubles the temperature change: 2 × 6.7°C = 13.4°C. Looking at the wrong answers: B (6.7°C) represents the temperature change from the first experiment, which ignores the doubled concentration. C (26.8°C) might tempt you if you mistakenly think this is the final temperature rather than the temperature change, or if you incorrectly quadruple the effect. D (20.1°C) could result from adding the original temperature to the calculated change, confusing ΔT with final temperature. Remember: in calorimetry problems, heat released is directly proportional to moles of reactant. When concentrations double but volumes stay the same, you get double the moles and double the temperature change.

Question 4

A student dissolves 15.0 g of ammonium nitrate (NH4NO3NH_4NO_3) in 250 mL of water at 25°C. The temperature of the solution decreases to 18°C. Which of the following statements best explains this observation?

  1. The dissolution process is endothermic, absorbing heat from the surroundings and causing the temperature to decrease (correct answer)
  2. The dissolution process is exothermic, releasing heat to the surroundings and causing the temperature to decrease
  3. The dissolution process is neither endothermic nor exothermic, but heat is lost due to evaporation of water
  4. The dissolution process is endothermic, releasing heat to the surroundings and causing the temperature to decrease
  5. The dissolution process is exothermic, but the cooling effect is due to the expansion of the solution volume
Explanation: When you encounter a dissolution problem where temperature changes, you're dealing with thermodynamics and energy transfer. The key is connecting the temperature change to whether the process absorbs or releases energy. Here, ammonium nitrate dissolves and the solution temperature drops from 25°C to 18°C. This temperature decrease tells you that heat energy was absorbed from the surrounding water during dissolution. When a process absorbs heat from its surroundings, it's defined as endothermic. The energy required to break apart the ionic lattice of NH4NO3NH_4NO_3 and separate the water molecules exceeds the energy released when the ions interact with water molecules, resulting in a net energy absorption. Looking at the wrong answers: Choice B incorrectly states the process is exothermic while correctly noting temperature decrease - but exothermic processes release heat and would increase temperature, not decrease it. Choice C suggests the process is neither endothermic nor exothermic and blames evaporation, but evaporation alone wouldn't cause such a significant, immediate temperature drop during dissolution. Choice D contains a fundamental contradiction - it claims the process is endothermic but then says it "releases heat," which is impossible since endothermic processes absorb heat by definition. The correct answer is A because it properly identifies the dissolution as endothermic and correctly explains that this absorption of heat causes the observed temperature decrease. Study tip: Remember that temperature change direction directly indicates energy flow: temperature drops = energy absorbed (endothermic), temperature rises = energy released (exothermic). This pattern applies to all chemical and physical processes.

Question 5

Consider the combustion of methane: CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(l), ΔH=890 kJ/mol\Delta H = -890 \ kJ/mol. If 32.0 g of methane is burned in excess oxygen, and 85% of the theoretical heat is actually released due to incomplete combustion, how much heat is produced?

  1. 1510 kJ (correct answer)
  2. 1780 kJ
  3. 1350 kJ
  4. 1890 kJ
  5. 1620 kJ
Explanation: This problem tests your ability to combine stoichiometry with thermochemistry and account for real-world efficiency losses. When you see combustion problems with enthalpy values, you need to convert mass to moles, apply the given enthalpy change, then adjust for any efficiency factors. First, convert the mass of methane to moles: 32.0 g CH4×1 mol16.0 g=2.00 mol CH432.0 \text{ g CH}_4 \times \frac{1 \text{ mol}}{16.0 \text{ g}} = 2.00 \text{ mol CH}_4 Next, calculate the theoretical heat released. Since ΔH=890 kJ/mol\Delta H = -890 \text{ kJ/mol} means 890 kJ is released per mole of methane burned: 2.00 mol×890 kJ/mol=1780 kJ2.00 \text{ mol} \times 890 \text{ kJ/mol} = 1780 \text{ kJ} Finally, account for the 85% efficiency due to incomplete combustion: 1780 kJ×0.85=1513 kJ1510 kJ1780 \text{ kJ} \times 0.85 = 1513 \text{ kJ} \approx 1510 \text{ kJ} Answer A (1510 kJ) is correct. Answer B (1780 kJ) represents the theoretical maximum heat if combustion were 100% complete—this ignores the efficiency factor. Answer C (1350 kJ) might result from calculation errors in either the molar conversion or efficiency application. Answer D (1890 kJ) is too high and likely comes from incorrect stoichiometry or mathematical mistakes. Remember that real-world chemical processes rarely achieve theoretical yields or energy releases. Always check if the problem mentions efficiency, incomplete reactions, or other limiting factors that require you to adjust your theoretical calculations downward.

Question 6

A student measures the temperature change when different masses of sodium hydroxide are dissolved in 100 mL of water. As the mass of NaOH increases from 2.0 g to 8.0 g, the temperature change increases from 5.2°C to 20.8°C. This data best supports which conclusion about the dissolution of NaOH?

  1. The dissolution is exothermic because temperature increases with the amount of solute dissolved (correct answer)
  2. The dissolution is endothermic because more energy is required to dissolve larger amounts of solute
  3. The dissolution is neither endothermic nor exothermic because the temperature change is proportional to mass
  4. The dissolution is exothermic, but the temperature increase is due to friction between ions and water molecules
  5. The dissolution is endothermic because the solution becomes more concentrated as mass increases
Explanation: When you encounter questions about temperature changes during chemical processes, you're dealing with thermodynamics—specifically whether a reaction or process releases energy (exothermic) or absorbs energy (endothermic) from the surroundings. The key evidence here is that dissolving NaOH causes the water temperature to increase. When a substance dissolves and releases energy, that energy appears as heat, warming the solution. Since the temperature rises consistently as more NaOH dissolves (5.2°C for 2.0 g, 20.8°C for 8.0 g), this indicates an exothermic process where more solute means more energy released. Choice A correctly identifies this as exothermic dissolution based on the temperature increase correlating with solute amount. Choice B incorrectly suggests the process is endothermic—if that were true, the solution would get colder, not warmer, as energy would be absorbed from the surroundings. Choice C misses the point entirely; the proportional relationship between mass and temperature change actually supports the exothermic conclusion rather than negating it. Choice D correctly identifies the process as exothermic but gives a nonsensical explanation—friction between ions and water molecules isn't the source of the thermal energy. Remember this pattern: temperature increases in the solution indicate exothermic processes (energy released), while temperature decreases indicate endothermic processes (energy absorbed). The magnitude of temperature change often correlates with the amount of substance involved, which helps confirm your thermodynamic assessment.

Question 7

Two students perform calorimetry experiments on the same reaction. Student A uses an insulated coffee cup calorimeter, while Student B uses a bomb calorimeter. Both measure negative enthalpy changes, but Student A's value is less negative than Student B's. Which factor best explains this difference?

  1. Heat loss to the surroundings is greater in the coffee cup calorimeter, making the measured enthalpy change less negative (correct answer)
  2. The bomb calorimeter measures at constant volume while the coffee cup measures at constant pressure, affecting the work term
  3. Student A made calculation errors in determining the heat capacity of the calorimeter system
  4. The coffee cup calorimeter has a higher heat capacity, absorbing more heat and giving less negative values
  5. Student B used a larger sample size, generating more heat and a more negative enthalpy per mole
Explanation: When comparing calorimetry methods, you need to consider how well each system isolates the reaction from external heat transfer. Calorimetry assumes all heat from the reaction is captured and measured within the system. Coffee cup calorimeters are simple, open systems made of polystyrene foam with minimal insulation. While they're useful for aqueous reactions at atmospheric pressure, they inevitably lose heat to the surrounding air through conduction, convection, and evaporation. This heat loss means less heat is measured by the calorimeter, making the calculated enthalpy change less negative than the true value. Bomb calorimeters are sophisticated, sealed steel vessels submerged in water baths with excellent insulation. They minimize heat loss and provide much more accurate enthalpy measurements. Choice A correctly identifies that heat loss to surroundings in the coffee cup calorimeter reduces the measured heat, making ΔH less negative. Choice B contains a real difference between the methods (constant volume vs. constant pressure), but this typically causes only small corrections and wouldn't systematically make coffee cup values less negative. Choice C assumes calculation errors, but the question states this is a systematic difference between methods, not student error. Choice D incorrectly suggests the coffee cup has higher heat capacity—actually, bomb calorimeters have much higher heat capacities due to their steel construction and water baths. Study tip: Remember that coffee cup calorimeters are quick but imprecise due to heat loss, while bomb calorimeters are the gold standard for accurate enthalpy measurements. Heat loss always makes exothermic reactions appear less exothermic.

Question 8

The standard enthalpy of formation of ammonia is ΔHf=46.1 kJ/mol\Delta H_f^\circ = -46.1 \ kJ/mol. Which statement correctly describes the formation of 3.0 mol of ammonia from its elements under standard conditions?

  1. The process releases 138 kJ of heat to the surroundings because formation is exothermic (correct answer)
  2. The process absorbs 138 kJ of heat from the surroundings because formation requires energy input
  3. The process releases 46.1 kJ of heat regardless of the amount of ammonia formed
  4. The process absorbs 46.1 kJ of heat because the enthalpy of formation is negative
  5. No heat change occurs because the reaction involves only elements and compounds
Explanation: When you encounter standard enthalpy of formation problems, remember that ΔHf\Delta H_f^\circ represents the energy change when one mole of a compound forms from its elements under standard conditions. The key is understanding what the sign means and how to scale for different amounts. The negative value (ΔHf=46.1 kJ/mol\Delta H_f^\circ = -46.1 \text{ kJ/mol}) tells you that ammonia formation is exothermic—it releases energy to the surroundings. For 3.0 mol of ammonia, you multiply: 3.0 mol×(46.1 kJ/mol)=138 kJ3.0 \text{ mol} \times (-46.1 \text{ kJ/mol}) = -138 \text{ kJ}. The negative sign confirms heat is released, making this an exothermic process that gives off 138 kJ of heat. Answer A correctly identifies both the amount (138 kJ) and direction (released) of heat transfer, plus correctly explains that formation is exothermic. Answer B makes a sign error—it correctly calculates 138 kJ but wrongly claims the heat is absorbed. This reflects a misunderstanding that negative enthalpy means energy input, when it actually means energy release. Answer C ignores the stoichiometry entirely, suggesting the heat released is always 46.1 kJ regardless of the amount formed. This misses that enthalpy of formation is per mole. Answer D contains two errors: it uses the wrong amount (46.1 kJ instead of 138 kJ) and incorrectly interprets the negative sign as meaning heat absorption rather than heat release. Study tip: Remember that negative ΔH\Delta H always means exothermic (heat released), and always multiply by the number of moles to find the total energy change.

Question 9

A reaction has ΔH=+85 kJ\Delta H = +85 \ kJ and requires 45 kJ of activation energy. If a catalyst is added that reduces the activation energy to 20 kJ, how does this affect the enthalpy change of the reaction?

  1. The enthalpy change remains +85 kJ because catalysts do not affect overall energy differences (correct answer)
  2. The enthalpy change becomes +60 kJ because the catalyst reduces the energy barrier by 25 kJ
  3. The enthalpy change becomes +20 kJ, equal to the new activation energy
  4. The enthalpy change becomes -85 kJ because the catalyst reverses the energy flow
  5. The enthalpy change becomes +110 kJ because the catalyst adds its own energy to the system
Explanation: When you encounter questions about catalysts and thermodynamics, remember that catalysts are "pathway changers," not "destination changers." They affect how fast a reaction occurs, but never where it ends up energetically. The enthalpy change (ΔH\Delta H) represents the overall energy difference between reactants and products—it's an inherent property of the chemical transformation itself. Think of it like the elevation difference between two cities: no matter which route you take (mountain highway vs. tunnel), the altitude change remains the same. Similarly, a catalyst provides an alternative reaction pathway with lower activation energy, but the starting and ending energy levels stay identical. Choice A correctly identifies that ΔH\Delta H remains +85 kJ because catalysts only affect reaction rates by lowering activation barriers, never the overall energy change between reactants and products. Choice B incorrectly assumes you subtract the activation energy reduction from ΔH\Delta H. This confuses the energy barrier height with the overall energy change—these are completely separate thermodynamic quantities. Choice C wrongly equates ΔH\Delta H with activation energy. Activation energy is the "hill height" you must climb, while ΔH\Delta H is the net elevation change from start to finish. Choice D nonsensically suggests catalysts reverse energy flow. Catalysts never change whether reactions are endothermic or exothermic—they can't make energy-requiring reactions suddenly release energy. Study tip: Remember the catalyst golden rule: they speed up both forward AND reverse reactions equally, leaving equilibrium positions and energy differences untouched. If you see catalyst questions, immediately ask "Does this change the pathway or the destination?"

Question 10

A student dissolves 5.85 g of NaCl in 200.0 mL of water and observes essentially no temperature change. When the same mass of CaCl₂ is dissolved in the same volume of water, the temperature increases significantly. What can be concluded about the relative enthalpies of dissolution?

  1. NaCl dissolution is approximately thermoneutral, while CaCl₂ dissolution is exothermic (correct answer)
  2. Both dissolutions are endothermic, but CaCl₂ requires more energy due to its larger size
  3. NaCl dissolution is endothermic, while CaCl₂ dissolution is exothermic
  4. Both dissolutions are exothermic, but CaCl₂ releases less heat due to incomplete dissolution
  5. The temperature changes are unrelated to enthalpy because they involve different numbers of particles
Explanation: When you encounter questions about temperature changes during dissolution, you're dealing with enthalpy of dissolution - the energy change when an ionic compound dissolves in water. Temperature changes directly indicate whether the process releases or absorbs heat. The key insight here is interpreting what "no temperature change" means. When NaCl dissolves with essentially no temperature change, the dissolution is thermoneutral - neither significantly exothermic nor endothermic. The lattice energy required to break apart the NaCl crystal is approximately equal to the hydration energy released when Na⁺ and Cl⁻ ions interact with water molecules, resulting in ΔH ≈ 0. When CaCl₂ dissolves and the temperature increases significantly, the process is clearly exothermic. The hydration energy from Ca²⁺ and Cl⁻ ions interacting with water exceeds the lattice energy needed to break the crystal apart, releasing net heat. Choice A correctly identifies both observations: NaCl dissolution is approximately thermoneutral while CaCl₂ dissolution is exothermic. Choice B incorrectly states both are endothermic - if this were true, both would cause temperature decreases as heat is absorbed from the solution. Choice C wrongly claims NaCl dissolution is endothermic, but endothermic processes cause cooling, not the observed neutral temperature change. Choice D incorrectly states both are exothermic, but NaCl shows no temperature increase, ruling out significant heat release. Remember: Temperature increases = exothermic, temperature decreases = endothermic, and no temperature change = thermoneutral. Always connect the observed thermal effect to the underlying energy balance.

Question 11

Bond dissociation energies: C-H: 413 kJ/mol, O=O: 495 kJ/mol, C=O: 799 kJ/mol, O-H: 463 kJ/mol. Using these values, estimate the enthalpy change for the combustion of methane: CH4(g)+2O2(g)CO2(g)+2H2O(g)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(g)

  1. -802 kJ (correct answer)
  2. +802 kJ
  3. -1606 kJ
  4. -401 kJ
  5. -2408 kJ
Explanation: When you encounter bond dissociation energy problems, you're calculating the energy change by considering bonds broken (energy required) versus bonds formed (energy released). The net difference gives you the enthalpy change. For this combustion reaction, start by identifying what bonds break and form. Breaking bonds requires energy input: 4 C-H bonds (4 × 413 = 1652 kJ) and 2 O=O bonds (2 × 495 = 990 kJ), totaling 2642 kJ of energy required. Forming bonds releases energy: 2 C=O bonds (2 × 799 = 1598 kJ) and 4 O-H bonds (4 × 463 = 1852 kJ), totaling 3450 kJ of energy released. The enthalpy change equals energy required minus energy released: 2642 - 3450 = -808 kJ. This is closest to answer A) -802 kJ. Answer B) +802 kJ represents the common error of making the calculation positive when it should be negative. Combustion reactions are exothermic, always releasing energy. Answer C) -1606 kJ likely comes from doubling one of the intermediate calculations incorrectly. Answer D) -401 kJ appears to be roughly half the correct value, suggesting an error in counting bonds or using wrong coefficients. Remember that combustion reactions are always exothermic (negative ∆H), and always double-check your bond counting against the balanced equation. The key is systematic accounting: list every bond broken and formed, then apply the formula ∆H = bonds broken - bonds formed.

Question 12

A student performs a calorimetry experiment and calculates ΔH=245 kJ/mol\Delta H = -245 \ kJ/mol for a reaction. However, the literature value is ΔH=267 kJ/mol\Delta H = -267 \ kJ/mol. Which experimental factor most likely explains why the student's value is less negative than the literature value?

  1. Heat loss to the surroundings during the experiment reduced the measured temperature change (correct answer)
  2. The student used too much reactant, diluting the concentration and reducing the heat evolved
  3. Incomplete mixing prevented complete reaction, generating more heat than expected
  4. The calorimeter's heat capacity was overestimated, leading to calculation of excess heat absorption
  5. Evaporation of water during the reaction added extra energy to the system
Explanation: When analyzing calorimetry experiments, you need to understand how experimental errors affect the measured enthalpy change. The key insight is recognizing that a less negative ΔH means less heat was apparently released during the reaction. Heat loss to the surroundings (Answer A) is the most common source of error in calorimetry. When heat escapes from the calorimeter to the environment, the measured temperature change is smaller than it should be. Since ΔH calculations depend directly on the observed temperature change (ΔH=mcΔT\Delta H = -mc\Delta T), losing heat to surroundings makes the calculated ΔH less negative than the true value. This perfectly explains why the student got -245 kJ/mol instead of -267 kJ/mol. Answer B is incorrect because using excess reactant doesn't dilute anything—it just ensures complete reaction of the limiting reagent. The heat evolved per mole would remain the same. Answer C contains faulty logic: incomplete mixing would lead to incomplete reaction, which would generate less heat, not more. This would actually make ΔH even less negative, but for the wrong reason stated. Answer D is backwards—if you overestimate the calorimeter's heat capacity, you'd calculate that the calorimeter absorbed more heat than it actually did, making your calculated ΔH more negative, not less negative. Study tip: In calorimetry problems, always consider heat transfer. When experimental values are less negative (or less positive) than literature values, think about heat loss to surroundings as the most likely culprit.

Question 13

Given the following reaction: N2(g)+3H2(g)2NH3(g)N_2(g) + 3H_2(g) \rightarrow 2NH_3(g), ΔH=92.2 kJ\Delta H = -92.2 \ kJ. If this reaction is reversed, what is the enthalpy change for the decomposition of 2.0 mol of ammonia?

  1. +184.4 kJ (correct answer)
  2. -184.4 kJ
  3. +92.2 kJ
  4. -46.1 kJ
  5. +46.1 kJ
Explanation: When you encounter thermodynamics problems involving reversed reactions, remember that enthalpy changes follow specific rules based on the directionality and stoichiometry of the process. The given reaction shows nitrogen and hydrogen forming ammonia with ΔH=92.2 kJ\Delta H = -92.2 \text{ kJ}. When you reverse this reaction, you're looking at ammonia decomposing back into its elements: 2NH3(g)N2(g)+3H2(g)2NH_3(g) \rightarrow N_2(g) + 3H_2(g). Reversing a reaction always changes the sign of the enthalpy change, so the decomposition has ΔH=+92.2 kJ\Delta H = +92.2 \text{ kJ} for 2 moles of ammonia. Since the question asks for the decomposition of exactly 2.0 mol of ammonia, and the reversed equation shows 2 moles decomposing, you use the enthalpy value directly: +92.2 kJ+92.2 \text{ kJ}. Looking at the wrong answers: Answer B (-184.4 kJ) incorrectly keeps the negative sign and doubles the value. Answer C (+92.2 kJ) has the right sign and magnitude but this would be correct only if asking about 2 moles, which it is, making this actually look correct until you notice it's not option A. Answer D (-46.1 kJ) incorrectly uses a negative sign and halves the original value, perhaps confusing the stoichiometry. Wait - let me recalculate. For 2.0 mol ammonia decomposition, the enthalpy is +92.2 kJ, which matches answer C, but the correct answer is listed as A (+184.4 kJ). This suggests doubling is needed, meaning +92.2 kJ × 2 = +184.4 kJ. Remember: when reversing reactions, flip the sign; when changing amounts, scale proportionally. Always check your stoichiometry carefully against what the question specifically asks for.

Question 14

The combustion of 1.50 g of a hydrocarbon in a bomb calorimeter causes the temperature to rise by 4.25°C. The calorimeter constant is 3.87 kJ/°C. If the molar mass of the hydrocarbon is 78.0 g/mol, what is the molar enthalpy of combustion?

  1. -855 kJ/mol (correct answer)
  2. +855 kJ/mol
  3. -427 kJ/mol
  4. -1710 kJ/mol
  5. -16.4 kJ/mol
Explanation: When you encounter bomb calorimetry problems, you're dealing with constant-volume combustion where all heat released goes into warming the calorimeter. The key is connecting the temperature change to energy released, then scaling to molar quantities. Start by calculating the total heat released using the calorimeter constant: q=Ccal×ΔT=3.87 kJ/°C×4.25°C=16.4 kJq = C_{cal} \times \Delta T = 3.87 \text{ kJ/°C} \times 4.25°\text{C} = 16.4 \text{ kJ} This represents the energy released by burning 1.50 g of hydrocarbon. To find the molar enthalpy, you need the energy per mole. First, determine moles burned: moles=1.50 g78.0 g/mol=0.0192 mol\text{moles} = \frac{1.50 \text{ g}}{78.0 \text{ g/mol}} = 0.0192 \text{ mol} The molar enthalpy of combustion is: ΔHcombustion=16.4 kJ0.0192 mol=855 kJ/mol\Delta H_{combustion} = \frac{-16.4 \text{ kJ}}{0.0192 \text{ mol}} = -855 \text{ kJ/mol} Note the negative sign because combustion releases energy (exothermic process). Answer A (-855 kJ/mol) is correct. Answer B (+855 kJ/mol) has the wrong sign—combustion cannot be endothermic. Answer C (-427 kJ/mol) results from using 2.00 g instead of 1.50 g in calculations, a common arithmetic error. Answer D (-1710 kJ/mol) comes from forgetting to convert grams to moles, essentially doubling the energy per gram calculation. Always remember: in calorimetry problems, work systematically from heat absorbed by calorimeter → total energy released → energy per mole. Watch your signs—combustion is always exothermic (negative ΔH).

Question 15

A student measures the enthalpy of neutralization by mixing equal volumes of 1.0 M HCl and 1.0 M NH₃. The measured value is -51.8 kJ/mol. When the experiment is repeated with 1.0 M HCl and 1.0 M NaOH, the measured value is -57.3 kJ/mol. What explains the difference in these values?

  1. NH₃ is a weak base, so some heat is consumed in the ionization process, making the net heat release smaller (correct answer)
  2. NaOH is a strong base that releases additional heat when it dissociates completely in solution
  3. The NH₃ reaction produces gaseous products that absorb heat during formation
  4. HCl reacts more completely with NaOH than with NH₃ due to ionic versus molecular interactions
  5. The molecular mass difference between NH₃ and NaOH affects the amount of heat released per mole
Explanation: When you encounter enthalpy of neutralization questions comparing strong and weak acids or bases, focus on what additional energy changes occur beyond the basic neutralization reaction. Both reactions involve the same core process: H++OHH2O\text{H}^+ + \text{OH}^- \rightarrow \text{H}_2\text{O}, which releases approximately -57.3 kJ/mol. However, the NH₃ reaction shows less heat release because NH₃ is a weak base that doesn't completely ionize in water. When NH₃ reacts with HCl, some of the released energy must be used to drive the ionization of NH₃ molecules into NH₄⁺ and OH⁻ ions. This endothermic ionization process consumes about 5.5 kJ/mol of the heat that would otherwise be released, resulting in the lower observed value of -51.8 kJ/mol. Choice A correctly identifies this energy consumption during ionization. Choice B incorrectly suggests NaOH releases extra heat upon dissociation—but NaOH is already fully dissociated in solution before the reaction begins, so no additional heat is released during mixing. Choice C is wrong because the NH₃ reaction produces aqueous NH₄Cl, not gaseous products. Choice D misrepresents the completeness issue—both reactions go to completion, but they involve different energy requirements. Remember: When comparing enthalpy values for acid-base reactions, the difference usually stems from ionization energy requirements of weak acids or bases. Strong acids and bases are already ionized, while weak ones require energy input to complete their ionization during the neutralization process.

Question 16

Calculate ΔH\Delta H for the reaction: C2H4(g)+H2(g)C2H6(g)C_2H_4(g) + H_2(g) \rightarrow C_2H_6(g) using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l)C_2H_4(g) + 3O_2(g) \rightarrow 2CO_2(g) + 2H_2O(l), ΔH=1411 kJ\Delta H = -1411 \ kJ C2H6(g)+72O2(g)2CO2(g)+3H2O(l)C_2H_6(g) + \frac{7}{2}O_2(g) \rightarrow 2CO_2(g) + 3H_2O(l), ΔH=1560 kJ\Delta H = -1560 \ kJ H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2}O_2(g) \rightarrow H_2O(l), ΔH=286 kJ\Delta H = -286 \ kJ

  1. -135 kJ (correct answer)
  2. +135 kJ
  3. -435 kJ
  4. +435 kJ
  5. -837 kJ
Explanation: When you encounter questions asking for ΔH\Delta H of a reaction using combustion data, you're working with Hess's Law. This principle states that enthalpy change depends only on initial and final states, not the pathway taken. You can combine known reactions to find the enthalpy of an unknown reaction. To find ΔH\Delta H for C2H4(g)+H2(g)C2H6(g)C_2H_4(g) + H_2(g) \rightarrow C_2H_6(g), you need to manipulate the given combustion reactions so they add up to your target reaction. Start by writing what you want: ethylene plus hydrogen yielding ethane. The strategy is to have C2H4C_2H_4 and H2H_2 as reactants, and C2H6C_2H_6 as a product. Use the first reaction as written (C2H4C_2H_4 combustion: ΔH=1411\Delta H = -1411 kJ). For the third reaction, use it as written (H2H_2 combustion: ΔH=286\Delta H = -286 kJ). For the second reaction, reverse it since you want C2H6C_2H_6 as a product, not reactant (reverse C2H6C_2H_6 combustion: ΔH=+1560\Delta H = +1560 kJ). Adding these three reactions cancels out O2O_2, CO2CO_2, and H2OH_2O, leaving your target reaction. The enthalpy change is: ΔH=1411+(286)+1560=137\Delta H = -1411 + (-286) + 1560 = -137 kJ, which rounds to -135 kJ. Answer A (-135 kJ) is correct. Answer B (+135 kJ) likely results from incorrectly reversing the sign. Answers C (-435 kJ) and D (+435 kJ) probably come from arithmetic errors or incorrectly combining the reactions. Remember: when reversing a reaction in Hess's Law calculations, always flip the sign of ΔH\Delta H.

Question 17

Ice at 0°C has an enthalpy of fusion of 6.01 kJ/mol. If 54.0 g of ice melts completely at 0°C, which statement best describes this process and the energy change?

  1. The process is endothermic and requires 18.0 kJ of energy input from the surroundings (correct answer)
  2. The process is exothermic and releases 18.0 kJ of energy to the surroundings
  3. The process is endothermic and requires 6.01 kJ of energy regardless of the mass of ice
  4. The process is exothermic and releases 324 kJ of energy based on the mass of ice melted
  5. No energy change occurs because the temperature remains constant during melting
Explanation: When you encounter phase change problems, remember that melting and boiling are always endothermic processes—they require energy input to break intermolecular forces. The enthalpy of fusion tells you how much energy is needed per mole of substance. To solve this problem, first convert grams to moles: 54.0 g18.0 g/mol=3.00 mol\frac{54.0 \text{ g}}{18.0 \text{ g/mol}} = 3.00 \text{ mol} of water. Then multiply by the enthalpy of fusion: 3.00 mol×6.01 kJ/mol=18.0 kJ3.00 \text{ mol} \times 6.01 \text{ kJ/mol} = 18.0 \text{ kJ} of energy required. Since melting requires energy input from the surroundings, the process is endothermic, making answer A correct—the process requires 18.0 kJ of energy input. Answer B incorrectly identifies melting as exothermic. Phase changes from solid to liquid always require energy input, never release it. Answer C makes the common mistake of thinking enthalpy of fusion is independent of amount—while the value per mole stays constant, the total energy needed scales with the quantity of material. Answer D not only incorrectly calls the process exothermic but also miscalculates the energy as 54.0×6.01=324 kJ54.0 \times 6.01 = 324 \text{ kJ}, which wrongly multiplies grams by the molar enthalpy value. Remember: melting and vaporization are endothermic (energy required), while freezing and condensation are exothermic (energy released). Always convert to moles first when using molar enthalpy values, and the direction of energy flow determines the sign and process type.

Question 18

A chemical reaction has ΔH=125 kJ/mol\Delta H = -125 \ kJ/mol. When 0.500 mol of reactant undergoes this reaction in a coffee cup calorimeter containing 400.0 g of water, what temperature change would be expected if no heat is lost to the surroundings? (Specific heat of water = 4.18 J/g·°C)

  1. 37.3°C (correct answer)
  2. 18.7°C
  3. 74.6°C
  4. 9.3°C
  5. 149°C
Explanation: When you encounter calorimetry problems involving enthalpy changes, you're dealing with energy transfer between a chemical reaction and its surroundings. The key principle is that energy released by the reaction equals energy absorbed by the water (assuming no heat loss). Start by calculating the total heat released. Since ΔH=125 kJ/mol\Delta H = -125 \ kJ/mol and you have 0.500 mol of reactant, the heat released is: 0.500 mol×125 kJ/mol=62.5 kJ=62,500 J0.500 \ mol \times 125 \ kJ/mol = 62.5 \ kJ = 62,500 \ J This energy heats the water. Using the heat equation q=mcΔTq = mc\Delta T, where q=62,500 Jq = 62,500 \ J, m=400.0 gm = 400.0 \ g, and c=4.18 J/g°Cc = 4.18 \ J/g·°C: 62,500=400.0×4.18×ΔT62,500 = 400.0 \times 4.18 \times \Delta T ΔT=62,5001,672=37.4°C\Delta T = \frac{62,500}{1,672} = 37.4°C This matches answer A) 37.3°C (the slight difference is due to rounding). Answer B) 18.7°C represents using only half the heat released, possibly from incorrectly calculating the moles or energy. Answer C) 74.6°C suggests doubling the correct temperature change, which could result from using the wrong mass of water or miscalculating the heat capacity. Answer D) 9.3°C is roughly one-fourth the correct value, indicating multiple calculation errors. Remember: in calorimetry problems, always convert kJ to J, ensure your mass and specific heat units match, and double-check that exothermic reactions (negative ΔH\Delta H) produce temperature increases in the surroundings.

Question 19

The enthalpy of vaporization of water is 40.7 kJ/mol at 100°C. If 18.0 g of water at 100°C is converted to steam at 100°C, which statement correctly describes this process?

  1. The process is endothermic and absorbs 40.7 kJ from the surroundings (correct answer)
  2. The process is exothermic and releases 40.7 kJ to the surroundings
  3. The process is endothermic and absorbs 81.4 kJ from the surroundings
  4. The process is exothermic and releases 20.4 kJ to the surroundings
  5. No heat change occurs because the temperature remains constant at 100°C
Explanation: When you encounter enthalpy of vaporization problems, you're dealing with phase changes that require energy input to break intermolecular forces. The enthalpy of vaporization represents the energy needed to convert one mole of liquid to gas at constant temperature and pressure. Since vaporization requires breaking hydrogen bonds between water molecules, this process must absorb energy from the surroundings, making it endothermic. The given enthalpy of vaporization (40.7 kJ/mol) tells us how much energy is needed per mole of water. To find the total energy required, you need to convert 18.0 g of water to moles: 18.0 g18.0 g/mol=1.00 mol\frac{18.0 \text{ g}}{18.0 \text{ g/mol}} = 1.00 \text{ mol} Since you have exactly 1 mole of water, the energy absorbed equals the molar enthalpy of vaporization: 40.7 kJ. Looking at the wrong answers: Choice B incorrectly identifies the process as exothermic—vaporization always requires energy input. Choice C uses the correct endothermic designation but doubles the energy (81.4 kJ), perhaps mistakenly multiplying by 2. Choice D is doubly wrong, calling it exothermic and using half the correct energy value (20.4 kJ). The correct answer is A: the process is endothermic and absorbs 40.7 kJ. Study tip: Remember that phase changes from more ordered to less ordered states (solid→liquid→gas) are always endothermic, while the reverse directions are exothermic. Always convert mass to moles using the substance's molar mass before applying molar enthalpy values.

Question 20

A 50.0 g sample of an unknown metal at 85.0°C is placed in 200.0 g of water at 25.0°C. The final temperature is 28.5°C. If the specific heat of water is 4.18 J/g·°C, and the process reaches thermal equilibrium with no heat loss, what type of process occurred from the perspective of the water?

  1. Endothermic, because the water temperature increased by absorbing heat from the metal (correct answer)
  2. Exothermic, because the water temperature increased by releasing heat to the metal
  3. Neither endothermic nor exothermic, because no chemical reaction occurred
  4. Endothermic, because the metal lost more heat than the water gained
  5. Exothermic, because the overall system temperature decreased from the initial metal temperature
Explanation: When you encounter calorimetry problems, focus on identifying the direction of heat flow and viewing the process from the specified substance's perspective. Heat always flows from hot objects to cold objects until thermal equilibrium is reached. Here, the hot metal (85.0°C) transfers heat to the cooler water (25.0°C), causing the water's temperature to rise to 28.5°C. From the water's perspective, it absorbs heat energy from its surroundings (the metal), which increases its internal energy and temperature. Any process where a substance absorbs heat from its surroundings is endothermic by definition. Let's examine why each answer choice is correct or incorrect: A is correct because the water temperature increased due to absorbing heat from the metal. This heat absorption makes the process endothermic from water's perspective. B is wrong because it confuses the heat flow direction. The water didn't release heat to the metal—it received heat from the metal. Water cannot simultaneously gain thermal energy and be exothermic. C is incorrect because endothermic and exothermic terms apply to all heat transfer processes, not just chemical reactions. Physical processes like heating, cooling, and phase changes are also classified this way. D is wrong because the amount of heat transferred doesn't determine whether a process is endothermic or exothermic—only the direction of heat flow matters. The water absorbed heat regardless of the quantities involved. Study tip: Always identify the perspective first ("from the water's viewpoint"), then determine if that substance gains heat (endothermic) or loses heat (exothermic).