Organic Chemistry Quiz: Iupac Naming Alkenes Alkynes Alkyl Halides
10 questions · exam conditions
0:00
Iupac Naming Alkenes Alkynes Alkyl HalidesQuestion 1 of 10

What is the correct IUPAC name for the compound with the structure: CH3CH2CH=CHCH(Br)CH2CH3CH_3CH_2CH=CHCH(Br)CH_2CH_3?

4-bromohept-2-ene
4-bromohept-3-ene
4-bromo-2-heptene
3-bromohept-4-ene
← Back to quizzes

Organic Chemistry Quiz

Organic Chemistry Quiz: Iupac Naming Alkenes Alkynes Alkyl Halides

Practice Iupac Naming Alkenes Alkynes Alkyl Halides in Organic Chemistry with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Iupac Naming Alkenes Alkynes Alkyl Halides, giving you a quick way to practice the rules, question types, and explanations that matter most for Organic Chemistry.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

What is the correct IUPAC name for the compound with the structure: CH3CH2CH=CHCH(Br)CH2CH3CH_3CH_2CH=CHCH(Br)CH_2CH_3?

  1. 4-bromohept-2-ene (correct answer)
  2. 4-bromohept-3-ene
  3. 4-bromo-2-heptene
  4. 3-bromohept-4-ene

Explanation: The correct IUPAC name is 4-bromohept-2-ene. The longest carbon chain has 7 carbons (hept-). The alkene takes priority over the halide, so we number to give the alkene the lowest possible number. Numbering from the left gives the alkene at position 2-3, while numbering from the right would give position 4-5. Therefore, we number from the left: the alkene is at position 2 (hept-2-ene) and the bromine is at position 4. Choice B incorrectly identifies the alkene position. Choice C uses outdated nomenclature. Choice D numbers from the wrong direction.

Question 2

A branched alkene has the structure where a 6-carbon chain contains a double bond and both a chlorine and methyl substituent. If the correct IUPAC name is '3-chloro-5-methylhex-1-ene', which statement about the numbering is true?

  1. The numbering was chosen to give the methyl group the lower number since it appears later alphabetically
  2. The chlorine was given priority because halogens take precedence over alkyl groups in numbering
  3. The alkene was given priority and numbered from the end closest to the double bond (correct answer)
  4. The numbering was arbitrary since multiple valid numbering systems exist for this molecule

Explanation: When naming complex organic molecules with multiple functional groups, IUPAC nomenclature follows a strict priority system. The most important rule is that certain functional groups take precedence over others when determining how to number the carbon chain. For alkenes, the double bond is the priority functional group that determines numbering direction. You must number the longest carbon chain from whichever end gives the double bond the lowest possible number. In '3-chloro-5-methylhex-1-ene', the "hex-1-ene" tells you the double bond starts at carbon 1, meaning the chain was numbered from the end closest to the double bond. This gives the alkene the lowest possible position number, which is required by IUPAC rules. Looking at the wrong answers: (A) is incorrect because alphabetical order only affects how substituents are listed in the name, not how the carbon chain is numbered. The methyl group's alphabetical position is irrelevant to numbering decisions. (B) is wrong because halogens don't take precedence over alkyl groups in determining chain numbering - both are simply substituents. The functional group (alkene) determines numbering, not the substituents. (D) is incorrect because IUPAC rules are very specific and unambiguous - there's only one correct way to number this molecule. Remember this key principle: always identify the highest priority functional group first (alkenes, alcohols, carbonyls, etc.), then number the chain to give that group the lowest possible number. Substituents like halogens and alkyl groups never determine numbering direction.

Question 3

An undergraduate student proposed the name (E)-5-bromo-2-methylhex-3-ene for a molecule they synthesized. Analysis revealed the connectivity was correct, but the IUPAC name was not. What is the primary error in the proposed name?

  1. The double bond should have been designated as (Z), not (E).
  2. The parent chain is a heptene, not a hexene.
  3. The numbering of the parent chain is incorrect. (correct answer)
  4. The substituents are not listed in correct alphabetical order.

Explanation: The structure is a hex-3-ene with a methyl at C2 and a bromo at C5 (based on the proposed name). The double bond is at C3 regardless of which end numbering starts. This creates a tie for the double bond locant. The tie is broken by assigning the lowest locants to the substituents. Both numbering schemes (left-to-right and right-to-left) give substituent locants of {2, 5}. The final tie-breaker is to give the substituent that comes first alphabetically the lower number. 'Bromo' comes before 'methyl'. Therefore, the chain must be numbered from right-to-left, placing the bromo group at C2 and the methyl group at C5. The proposed name, which places bromo at C5, resulted from incorrect numbering.

Question 4

Which of the following IUPAC names is invalid because it violates the rule for selecting the parent chain?

  1. 4-vinylcyclohexene
  2. 3-methyl-1-butyne
  3. 4-ethenyloctane (correct answer)
  4. 5,5-dibromo-2-pentyne

Explanation: The fundamental IUPAC rule for naming alkenes and alkynes is that the parent chain must be the longest carbon chain that contains the multiple bond(s). The name '4-ethenyloctane' implies an eight-carbon parent chain (octane) with a two-carbon substituent containing a double bond (ethenyl, or vinyl) at C4. However, the longest chain containing the double bond would start from the ethenyl group and go through the octane chain, resulting in a different parent chain (e.g., a decene). The correct name would be 5-propyl-1-octene. Therefore, '4-ethenyloctane' is an invalid name because it prioritizes the longest overall carbon chain instead of the longest chain containing the principal functional group.

Question 5

Which compound would be correctly named as 3-chloro-4-methylpent-1-ene according to IUPAC nomenclature?

  1. CH2=C(Cl)CH2CH(CH3)CH3CH_2=C(Cl)CH_2CH(CH_3)CH_3
  2. CH3CH(CH3)CH(Cl)CH=CH2CH_3CH(CH_3)CH(Cl)CH=CH_2
  3. CH2=CHCH(Cl)CH(CH3)CH3CH_2=CHCH(Cl)CH(CH_3)CH_3 (correct answer)
  4. CH3CH(Cl)CH(CH3)CH=CH2CH_3CH(Cl)CH(CH_3)CH=CH_2

Explanation: When naming alkenes with IUPAC nomenclature, you must first identify the longest carbon chain containing the double bond, then number from the end that gives the double bond the lowest possible number. The double bond takes priority over all other substituents in numbering. For the name "3-chloro-4-methylpent-1-ene," you need a 5-carbon chain with a double bond starting at carbon 1, chlorine at carbon 3, and methyl at carbon 4. Option C (CH2=CHCH(Cl)CH(CH3)CH3CH_2=CHCH(Cl)CH(CH_3)CH_3) is correct. Starting from the left (to give the double bond position 1), you have: C1=C2 (double bond), C3 has chlorine, C4 has methyl, and C5 completes the pentane chain. This matches the required name perfectly. Option A (CH2=C(Cl)CH2CH(CH3)CH3CH_2=C(Cl)CH_2CH(CH_3)CH_3) places chlorine on carbon 2, not carbon 3. This would be named 2-chloro-4-methylpent-1-ene. Option B (CH3CH(CH3)CH(Cl)CH=CH2CH_3CH(CH_3)CH(Cl)CH=CH_2) has the double bond at the wrong end. When numbered correctly (from the right to give the double bond the lowest number), chlorine would be at carbon 2 and methyl at carbon 4, making this 2-chloro-4-methylpent-1-ene. Option D (CH3CH(Cl)CH(CH3)CH=CH2CH_3CH(Cl)CH(CH_3)CH=CH_2) also has the double bond at the wrong end. Proper numbering puts chlorine at carbon 3 and methyl at carbon 2, giving 3-chloro-2-methylpent-1-ene. Remember: always number the carbon chain to give the double bond the lowest possible number first, then assign positions to substituents based on that numbering system.

Question 6

The structure ClCH2CH2CCCH(CH3)CH2CH3ClCH_2CH_2C≡CCH(CH_3)CH_2CH_3 contains both an alkyne and an alkyl halide. What is the correct IUPAC name?

  1. 1-chlorooct-4-yne
  2. 6-methylhept-3-yn-1-yl chloride
  3. 8-chloro-6-methyloct-4-yne
  4. 1-chloro-6-methyloct-4-yne (correct answer)

Explanation: The correct name is 1-chloro-6-methyloct-4-yne. The longest chain has 8 carbons (oct-). The alkyne functional group takes priority and should receive the lowest possible number. Numbering from the left gives the alkyne at position 4, while numbering from the right would give position 5. With this numbering, chlorine is at position 1 and methyl is at position 6. Choice A omits the methyl substituent. Choice B uses incorrect nomenclature. Choice C numbers from the wrong direction, putting chlorine at position 8 instead of 1.

Question 7

A molecule has the IUPAC name (E)-4-isopropyl-3-methylhept-3-ene. Which statement correctly describes the Cahn-Ingold-Prelog (CIP) priorities of the groups attached to the double bond carbons?

  1. On C3, ethyl has higher priority than methyl; on C4, propyl has higher priority than isopropyl.
  2. On C3, methyl has higher priority than ethyl; on C4, isopropyl has higher priority than propyl.
  3. On C3, ethyl has higher priority than methyl; on C4, isopropyl has higher priority than propyl. (correct answer)
  4. On C3, methyl has higher priority than ethyl; on C4, propyl has higher priority than isopropyl.

Explanation: The molecule is hept-3-ene, so the double bond is between C3 and C4. On C3, the attached alkyl groups are methyl (from the name) and ethyl (C1-C2 of the heptene chain). Comparing ethyl (-CH2CH3) and methyl (-CH3), ethyl has a higher priority because the carbon of the CH2 is attached to another carbon, whereas the carbon of the CH3 is attached only to hydrogens. On C4, the attached alkyl groups are isopropyl (from the name) and propyl (C5-C6-C7 of the heptene chain). Comparing isopropyl (-CH(CH3)2) and n-propyl (-CH2CH2CH3), isopropyl has higher priority because its alpha-carbon is attached to two other carbons, while the alpha-carbon of n-propyl is attached to only one other carbon.

Question 8

A student incorrectly names a compound 4-methyl-3-chloro-1-pentyne. What is the correct IUPAC name?

  1. 3-chloro-4-methyl-1-pentyne
  2. 3-chloro-2-methyl-4-pentyne
  3. 4-methyl-3-chloropent-1-yne
  4. 3-chloro-4-methylpent-1-yne (correct answer)

Explanation: The student's name '4-methyl-3-chloro-1-pentyne' correctly identifies the parent chain (pentyne), the position of the alkyne (1), and the positions of the substituents (methyl at 4, chloro at 3). The only error is the alphabetical ordering of substituents. In IUPAC nomenclature, substituents must be listed in alphabetical order regardless of their position numbers. 'Chloro' comes before 'methyl' alphabetically, so the chloro group must be cited first. The correct name is 3-chloro-4-methylpent-1-yne, following modern IUPAC format where the locant precedes the suffix.

Question 9

The alkyne CH3CH2CCCH2CH2ICH_3CH_2C≡CCH_2CH_2I should be named as 6-iodohex-3-yne, but a student incorrectly wrote '1-iodohex-3-yne'. What error in reasoning led to this mistake?

  1. The student incorrectly identified iodine as having higher priority than the alkyne functional group
  2. The student numbered from the wrong end of the molecule, not giving the alkyne the lowest number
  3. The student failed to recognize that iodine should be named as a substituent rather than part of the main chain
  4. The student correctly identified the alkyne position but miscounted the position of the iodine substituent (correct answer)

Explanation: The correct answer is D. Both names show 'hex-3-yne', indicating the student correctly identified the alkyne position. However, with proper numbering (giving alkyne the lowest number), iodine is at position 6, not position 1. The student made an error in counting or identifying the iodine's position. Choice A is incorrect because functional groups always take priority over halogens. Choice B is wrong because both names have the alkyne at position 3. Choice C is incorrect because the student did treat iodine as a substituent.

Question 10

The compound CH3CHClCH2CCHCH_3CHClCH_2C≡CH contains both an alkyne and an alkyl halide. If a student writes the name as '2-chloropent-4-yne' instead of the correct name, what is the most likely error?

  1. The student gave chlorine priority over the alkyne functional group in numbering
  2. The student numbered from the wrong end, not giving the alkyne the lowest possible number (correct answer)
  3. The student miscounted the total number of carbons in the main chain
  4. The student incorrectly identified the position of the chlorine substituent

Explanation: The correct answer is B. The correct name should be 4-chloropent-1-yne. The alkyne functional group must receive the lowest possible number. Numbering from the alkyne end gives: C≡C at position 1, and Cl at position 4. The student's answer '2-chloropent-4-yne' suggests they numbered from the opposite end, putting the alkyne at position 4 instead of 1. Choice A is incorrect because the student did recognize the alkyne (pent-yne). Choice C is wrong because both names use 'pent' (5 carbons). Choice D is incorrect because the error is in the overall numbering direction, not just the Cl position.